C13H18BrF3N2O2 — CID 103151651
[1-(5-bromo-2-methoxyphenyl)-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine (PubChem CID 103151651) has the molecular formula C13H18BrF3N2O2 and a molecular weight of 371.20 g/mol. Its IUPAC name is [1-(5-bromo-2-methoxyphenyl)-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine.
| Compound Name | [1-(5-bromo-2-methoxyphenyl)-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103151651 |
| Molecular Formula | C13H18BrF3N2O2 |
| Molecular Weight | 371.20 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | [1-(5-bromo-2-methoxyphenyl)-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine |
| SMILES | COc1ccc(Br)cc1CC(CCOCC(F)(F)F)NN |
| InChI | InChI=1S/C13H18BrF3N2O2/c1-20-12-3-2-10(14)6-9(12)7-11(19-18)4-5-21-8-13(15,16)17/h2-3,6,11,19H,4-5,7-8,18H2,1H3 |
| InChIKey | NHFLWTRTYYBKBJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.20 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|