C14H22F2N2O2 — CID 103151784
[4-(2,2-difluoroethoxy)-1-(2-methoxy-5-methylphenyl)butan-2-yl]hydrazine (PubChem CID 103151784) has the molecular formula C14H22F2N2O2 and a molecular weight of 288.34 g/mol. Its IUPAC name is [4-(2,2-difluoroethoxy)-1-(2-methoxy-5-methylphenyl)butan-2-yl]hydrazine.
| Compound Name | [4-(2,2-difluoroethoxy)-1-(2-methoxy-5-methylphenyl)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103151784 |
| Molecular Formula | C14H22F2N2O2 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | [4-(2,2-difluoroethoxy)-1-(2-methoxy-5-methylphenyl)butan-2-yl]hydrazine |
| SMILES | COc1ccc(C)cc1CC(CCOCC(F)F)NN |
| InChI | InChI=1S/C14H22F2N2O2/c1-10-3-4-13(19-2)11(7-10)8-12(18-17)5-6-20-9-14(15)16/h3-4,7,12,14,18H,5-6,8-9,17H2,1-2H3 |
| InChIKey | SJVOUPGXDMHVMF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|