C12H15BrF3NO2 — CID 103207108
1-(3-bromo-4-methoxyphenyl)-3-(2,2,2-trifluoroethoxy)propan-1-amine (PubChem CID 103207108) has the molecular formula C12H15BrF3NO2 and a molecular weight of 342.16 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxyphenyl)-3-(2,2,2-trifluoroethoxy)propan-1-amine.
| Compound Name | 1-(3-bromo-4-methoxyphenyl)-3-(2,2,2-trifluoroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 103207108 |
| Molecular Formula | C12H15BrF3NO2 |
| Molecular Weight | 342.16 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 1-(3-bromo-4-methoxyphenyl)-3-(2,2,2-trifluoroethoxy)propan-1-amine |
| SMILES | COc1ccc(C(N)CCOCC(F)(F)F)cc1Br |
| InChI | InChI=1S/C12H15BrF3NO2/c1-18-11-3-2-8(6-9(11)13)10(17)4-5-19-7-12(14,15)16/h2-3,6,10H,4-5,7,17H2,1H3 |
| InChIKey | SOPFNCXKZUNXGG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.16 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|