C12H14BrF3O2 — CID 115515338
1-(3-bromo-4-methoxyphenyl)-5,5,5-trifluoropentan-1-ol (PubChem CID 115515338) has the molecular formula C12H14BrF3O2 and a molecular weight of 327.14 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxyphenyl)-5,5,5-trifluoropentan-1-ol.
| Compound Name | 1-(3-bromo-4-methoxyphenyl)-5,5,5-trifluoropentan-1-ol |
|---|---|
| PubChem CID | 115515338 |
| Molecular Formula | C12H14BrF3O2 |
| Molecular Weight | 327.14 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 1-(3-bromo-4-methoxyphenyl)-5,5,5-trifluoropentan-1-ol |
| SMILES | COc1ccc(C(O)CCCC(F)(F)F)cc1Br |
| InChI | InChI=1S/C12H14BrF3O2/c1-18-11-5-4-8(7-9(11)13)10(17)3-2-6-12(14,15)16/h4-5,7,10,17H,2-3,6H2,1H3 |
| InChIKey | OKUUXUPUFKWYEH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.14 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |