C10H13BrO2S — CID 116830964
1-(3-bromo-4-methoxyphenyl)-3-sulfanylpropan-1-ol (PubChem CID 116830964) has the molecular formula C10H13BrO2S and a molecular weight of 277.18 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxyphenyl)-3-sulfanylpropan-1-ol.
| Compound Name | 1-(3-bromo-4-methoxyphenyl)-3-sulfanylpropan-1-ol |
|---|---|
| PubChem CID | 116830964 |
| Molecular Formula | C10H13BrO2S |
| Molecular Weight | 277.18 g/mol |
| Exact Mass | 275.98 |
| IUPAC Name | 1-(3-bromo-4-methoxyphenyl)-3-sulfanylpropan-1-ol |
| SMILES | COc1ccc(C(O)CCS)cc1Br |
| InChI | InChI=1S/C10H13BrO2S/c1-13-10-3-2-7(6-8(10)11)9(12)4-5-14/h2-3,6,9,12,14H,4-5H2,1H3 |
| InChIKey | YSQWGZOMCOPDFU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.18 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|