C9H11BrO3 — CID 11390954
(1S)-1-(3-bromo-4-methoxyphenyl)ethane-1,2-diol (PubChem CID 11390954) has the molecular formula C9H11BrO3 and a molecular weight of 247.09 g/mol. Its IUPAC name is (1S)-1-(3-bromo-4-methoxyphenyl)ethane-1,2-diol.
| Compound Name | (1S)-1-(3-bromo-4-methoxyphenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 11390954 |
| Molecular Formula | C9H11BrO3 |
| Molecular Weight | 247.09 g/mol |
| Exact Mass | 245.99 |
| IUPAC Name | (1S)-1-(3-bromo-4-methoxyphenyl)ethane-1,2-diol |
| SMILES | COc1ccc([C@H](O)CO)cc1Br |
| InChI | InChI=1S/C9H11BrO3/c1-13-9-3-2-6(4-7(9)10)8(12)5-11/h2-4,8,11-12H,5H2,1H3/t8-/m1/s1 |
| InChIKey | BHURKAYFBQRINA-MRVPVSSYSA-N |
| XLogP | 1.48 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.09 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |