C11H16O3 — CID 82281977
1-(3-ethyl-4-methoxyphenyl)ethane-1,2-diol (PubChem CID 82281977) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-(3-ethyl-4-methoxyphenyl)ethane-1,2-diol.
| Compound Name | 1-(3-ethyl-4-methoxyphenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 82281977 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 1-(3-ethyl-4-methoxyphenyl)ethane-1,2-diol |
| SMILES | CCc1cc(C(O)CO)ccc1OC |
| InChI | InChI=1S/C11H16O3/c1-3-8-6-9(10(13)7-12)4-5-11(8)14-2/h4-6,10,12-13H,3,7H2,1-2H3 |
| InChIKey | SQOKHRBNFLAYLC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |