C22H30O6 — CID 118987415
1,6-bis(3,4-dimethoxyphenyl)hexane-1,6-diol (PubChem CID 118987415) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is 1,6-bis(3,4-dimethoxyphenyl)hexane-1,6-diol.
| Compound Name | 1,6-bis(3,4-dimethoxyphenyl)hexane-1,6-diol |
|---|---|
| PubChem CID | 118987415 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 1,6-bis(3,4-dimethoxyphenyl)hexane-1,6-diol |
| SMILES | COc1ccc(C(O)CCCCC(O)c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C22H30O6/c1-25-19-11-9-15(13-21(19)27-3)17(23)7-5-6-8-18(24)16-10-12-20(26-2)22(14-16)28-4/h9-14,17-18,23-24H,5-8H2,1-4H3 |
| InChIKey | MJYKQEPVCZLJEF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|