C14H22O3 — CID 61099857
1-(3,4-dimethoxyphenyl)-4-methylpentan-1-ol (PubChem CID 61099857) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-4-methylpentan-1-ol.
| Compound Name | 1-(3,4-dimethoxyphenyl)-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 61099857 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-4-methylpentan-1-ol |
| SMILES | COc1ccc(C(O)CCC(C)C)cc1OC |
| InChI | InChI=1S/C14H22O3/c1-10(2)5-7-12(15)11-6-8-13(16-3)14(9-11)17-4/h6,8-10,12,15H,5,7H2,1-4H3 |
| InChIKey | MUBAWRFUFUNYTO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |