C12H18O5S — CID 55095988
1-(3,4-dimethoxyphenyl)-3-methylsulfonylpropan-1-ol (PubChem CID 55095988) has the molecular formula C12H18O5S and a molecular weight of 274.34 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-methylsulfonylpropan-1-ol.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-methylsulfonylpropan-1-ol |
|---|---|
| PubChem CID | 55095988 |
| Molecular Formula | C12H18O5S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-methylsulfonylpropan-1-ol |
| SMILES | COc1ccc(C(O)CCS(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C12H18O5S/c1-16-11-5-4-9(8-12(11)17-2)10(13)6-7-18(3,14)15/h4-5,8,10,13H,6-7H2,1-3H3 |
| InChIKey | XULSRWHWKSHNNK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |