C13H21NO4S — CID 142700262
1-(3-ethoxy-4-methoxyphenyl)-3-methylsulfonylpropan-1-amine (PubChem CID 142700262) has the molecular formula C13H21NO4S and a molecular weight of 287.38 g/mol. Its IUPAC name is 1-(3-ethoxy-4-methoxyphenyl)-3-methylsulfonylpropan-1-amine.
| Compound Name | 1-(3-ethoxy-4-methoxyphenyl)-3-methylsulfonylpropan-1-amine |
|---|---|
| PubChem CID | 142700262 |
| Molecular Formula | C13H21NO4S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 1-(3-ethoxy-4-methoxyphenyl)-3-methylsulfonylpropan-1-amine |
| SMILES | CCOc1cc(C(N)CCS(C)(=O)=O)ccc1OC |
| InChI | InChI=1S/C13H21NO4S/c1-4-18-13-9-10(5-6-12(13)17-2)11(14)7-8-19(3,15)16/h5-6,9,11H,4,7-8,14H2,1-3H3 |
| InChIKey | USACBNXQYYDLOZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |