C12H20NO4S+ — CID 142314842
[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]azanium (PubChem CID 142314842) has the molecular formula C12H20NO4S+ and a molecular weight of 274.36 g/mol. Its IUPAC name is [1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]azanium.
| Compound Name | [1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]azanium |
|---|---|
| PubChem CID | 142314842 |
| Molecular Formula | C12H20NO4S+ |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | [1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]azanium |
| SMILES | CCOc1cc(C([NH3+])CS(C)(=O)=O)ccc1OC |
| InChI | InChI=1S/C12H19NO4S/c1-4-17-12-7-9(5-6-11(12)16-2)10(13)8-18(3,14)15/h5-7,10H,4,8,13H2,1-3H3/p+1 |
| InChIKey | BXUJVINGXQGNFD-UHFFFAOYSA-O |
| XLogP | 0.42 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |