C18H22O4S — CID 69484833
2-ethoxy-1-methoxy-4-(2-methylsulfonyl-1-phenylethyl)benzene (PubChem CID 69484833) has the molecular formula C18H22O4S and a molecular weight of 334.44 g/mol. Its IUPAC name is 2-ethoxy-1-methoxy-4-(2-methylsulfonyl-1-phenylethyl)benzene.
| Compound Name | 2-ethoxy-1-methoxy-4-(2-methylsulfonyl-1-phenylethyl)benzene |
|---|---|
| PubChem CID | 69484833 |
| Molecular Formula | C18H22O4S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 2-ethoxy-1-methoxy-4-(2-methylsulfonyl-1-phenylethyl)benzene |
| SMILES | CCOc1cc(C(CS(C)(=O)=O)c2ccccc2)ccc1OC |
| InChI | InChI=1S/C18H22O4S/c1-4-22-18-12-15(10-11-17(18)21-2)16(13-23(3,19)20)14-8-6-5-7-9-14/h5-12,16H,4,13H2,1-3H3 |
| InChIKey | RYMIQXGAQAKEAS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |