C17H22NO2+ — CID 4712217
[(3,4-diethoxyphenyl)-phenylmethyl]azanium (PubChem CID 4712217) has the molecular formula C17H22NO2+ and a molecular weight of 272.37 g/mol. Its IUPAC name is [(3,4-diethoxyphenyl)-phenylmethyl]azanium.
| Compound Name | [(3,4-diethoxyphenyl)-phenylmethyl]azanium |
|---|---|
| PubChem CID | 4712217 |
| Molecular Formula | C17H22NO2+ |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | [(3,4-diethoxyphenyl)-phenylmethyl]azanium |
| SMILES | CCOc1ccc(C([NH3+])c2ccccc2)cc1OCC |
| InChI | InChI=1S/C17H21NO2/c1-3-19-15-11-10-14(12-16(15)20-4-2)17(18)13-8-6-5-7-9-13/h5-12,17H,3-4,18H2,1-2H3/p+1 |
| InChIKey | SORPYFIKHAVNIY-UHFFFAOYSA-O |
| XLogP | 2.82 |
| TPSA | 46.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |