C17H19ClO2 — CID 61080986
4-[chloro(phenyl)methyl]-1,2-diethoxybenzene (PubChem CID 61080986) has the molecular formula C17H19ClO2 and a molecular weight of 290.79 g/mol. Its IUPAC name is 4-[chloro(phenyl)methyl]-1,2-diethoxybenzene.
| Compound Name | 4-[chloro(phenyl)methyl]-1,2-diethoxybenzene |
|---|---|
| PubChem CID | 61080986 |
| Molecular Formula | C17H19ClO2 |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 4-[chloro(phenyl)methyl]-1,2-diethoxybenzene |
| SMILES | CCOc1ccc(C(Cl)c2ccccc2)cc1OCC |
| InChI | InChI=1S/C17H19ClO2/c1-3-19-15-11-10-14(12-16(15)20-4-2)17(18)13-8-6-5-7-9-13/h5-12,17H,3-4H2,1-2H3 |
| InChIKey | VWPWRCSBSQXZOQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|