C15H16Cl2O3 — CID 106688988
2-chloro-5-[chloro-(3,4-diethoxyphenyl)methyl]furan (PubChem CID 106688988) has the molecular formula C15H16Cl2O3 and a molecular weight of 315.20 g/mol. Its IUPAC name is 2-chloro-5-[chloro-(3,4-diethoxyphenyl)methyl]furan.
| Compound Name | 2-chloro-5-[chloro-(3,4-diethoxyphenyl)methyl]furan |
|---|---|
| PubChem CID | 106688988 |
| Molecular Formula | C15H16Cl2O3 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 2-chloro-5-[chloro-(3,4-diethoxyphenyl)methyl]furan |
| SMILES | CCOc1ccc(C(Cl)c2ccc(Cl)o2)cc1OCC |
| InChI | InChI=1S/C15H16Cl2O3/c1-3-18-11-6-5-10(9-13(11)19-4-2)15(17)12-7-8-14(16)20-12/h5-9,15H,3-4H2,1-2H3 |
| InChIKey | ROEKKASIQOBDOZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|