C13H19ClO4 — CID 171863308
3-chloro-1-(3,4-diethoxyphenyl)propane-1,2-diol (PubChem CID 171863308) has the molecular formula C13H19ClO4 and a molecular weight of 274.74 g/mol. Its IUPAC name is 3-chloro-1-(3,4-diethoxyphenyl)propane-1,2-diol.
| Compound Name | 3-chloro-1-(3,4-diethoxyphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 171863308 |
| Molecular Formula | C13H19ClO4 |
| Molecular Weight | 274.74 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 3-chloro-1-(3,4-diethoxyphenyl)propane-1,2-diol |
| SMILES | CCOc1ccc(C(O)C(O)CCl)cc1OCC |
| InChI | InChI=1S/C13H19ClO4/c1-3-17-11-6-5-9(7-12(11)18-4-2)13(16)10(15)8-14/h5-7,10,13,15-16H,3-4,8H2,1-2H3 |
| InChIKey | FVJFRYLFYJLOPE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.74 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|