C12H19NO3 — CID 18627975
2-amino-1-(3,4-diethoxyphenyl)ethanol (PubChem CID 18627975) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 2-amino-1-(3,4-diethoxyphenyl)ethanol.
| Compound Name | 2-amino-1-(3,4-diethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 18627975 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 2-amino-1-(3,4-diethoxyphenyl)ethanol |
| SMILES | CCOc1ccc(C(O)CN)cc1OCC |
| InChI | InChI=1S/C12H19NO3/c1-3-15-11-6-5-9(10(14)8-13)7-12(11)16-4-2/h5-7,10,14H,3-4,8,13H2,1-2H3 |
| InChIKey | MHZKJOSBJYJMHA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |