C14H16ClNO3 — CID 153401304
2-amino-1-[3,4-bis(prop-2-ynoxy)phenyl]ethanol;hydrochloride (PubChem CID 153401304) has the molecular formula C14H16ClNO3 and a molecular weight of 281.74 g/mol. Its IUPAC name is 2-amino-1-[3,4-bis(prop-2-ynoxy)phenyl]ethanol;hydrochloride.
| Compound Name | 2-amino-1-[3,4-bis(prop-2-ynoxy)phenyl]ethanol;hydrochloride |
|---|---|
| PubChem CID | 153401304 |
| Molecular Formula | C14H16ClNO3 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-amino-1-[3,4-bis(prop-2-ynoxy)phenyl]ethanol;hydrochloride |
| SMILES | C#CCOc1ccc(C(O)CN)cc1OCC#C.Cl |
| InChI | InChI=1S/C14H15NO3.ClH/c1-3-7-17-13-6-5-11(12(16)10-15)9-14(13)18-8-4-2;/h1-2,5-6,9,12,16H,7-8,10,15H2;1H |
| InChIKey | PPKDWHHSPQBROJ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|