C17H17NO3 — CID 146368815
2-[3,4-bis(prop-2-ynoxy)phenyl]-2-prop-2-ynoxyethanamine (PubChem CID 146368815) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-[3,4-bis(prop-2-ynoxy)phenyl]-2-prop-2-ynoxyethanamine.
| Compound Name | 2-[3,4-bis(prop-2-ynoxy)phenyl]-2-prop-2-ynoxyethanamine |
|---|---|
| PubChem CID | 146368815 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-[3,4-bis(prop-2-ynoxy)phenyl]-2-prop-2-ynoxyethanamine |
| SMILES | C#CCOc1ccc(C(CN)OCC#C)cc1OCC#C |
| InChI | InChI=1S/C17H17NO3/c1-4-9-19-15-8-7-14(12-16(15)20-10-5-2)17(13-18)21-11-6-3/h1-3,7-8,12,17H,9-11,13,18H2 |
| InChIKey | PLXQGCYFALWPML-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|