C11H13NO3 — CID 146368643
4-(2-amino-1-prop-2-ynoxyethyl)benzene-1,2-diol (PubChem CID 146368643) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 4-(2-amino-1-prop-2-ynoxyethyl)benzene-1,2-diol.
| Compound Name | 4-(2-amino-1-prop-2-ynoxyethyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 146368643 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 4-(2-amino-1-prop-2-ynoxyethyl)benzene-1,2-diol |
| SMILES | C#CCOC(CN)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H13NO3/c1-2-5-15-11(7-12)8-3-4-9(13)10(14)6-8/h1,3-4,6,11,13-14H,5,7,12H2 |
| InChIKey | UBAMSWOAPSPMSI-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|