C8H12KNO3 — CID 173424167
potassium;4-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol;hydride (PubChem CID 173424167) has the molecular formula C8H12KNO3 and a molecular weight of 209.29 g/mol. Its IUPAC name is potassium;4-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol;hydride.
| Compound Name | potassium;4-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol;hydride |
|---|---|
| PubChem CID | 173424167 |
| Molecular Formula | C8H12KNO3 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | potassium;4-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol;hydride |
| SMILES | NC[C@H](O)c1ccc(O)c(O)c1.[H-].[K+] |
| InChI | InChI=1S/C8H11NO3.K.H/c9-4-8(12)5-1-2-6(10)7(11)3-5;;/h1-3,8,10-12H,4,9H2;;/q;+1;-1/t8-;;/m0../s1 |
| InChIKey | LRZFSHZHYWUQIE-JZGIKJSDSA-N |
| XLogP | -2.79 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|