C8H12NO3+ — CID 6921839
[(2S)-2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]azanium (PubChem CID 6921839) has the molecular formula C8H12NO3+ and a molecular weight of 170.19 g/mol. Its IUPAC name is [(2S)-2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]azanium.
| Compound Name | [(2S)-2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]azanium |
|---|---|
| PubChem CID | 6921839 |
| Molecular Formula | C8H12NO3+ |
| Molecular Weight | 170.19 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | [(2S)-2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]azanium |
| SMILES | [NH3+]C[C@@H](O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H11NO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8,10-12H,4,9H2/p+1/t8-/m1/s1 |
| InChIKey | SFLSHLFXELFNJZ-MRVPVSSYSA-O |
| XLogP | -0.63 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.19 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|