C20H28O6 — CID 162227064
4-[(1S)-1-hydroxybutyl]benzene-1,2-diol;4-[(1R)-1-hydroxybutyl]benzene-1,2-diol (PubChem CID 162227064) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is 4-[(1S)-1-hydroxybutyl]benzene-1,2-diol;4-[(1R)-1-hydroxybutyl]benzene-1,2-diol.
| Compound Name | 4-[(1S)-1-hydroxybutyl]benzene-1,2-diol;4-[(1R)-1-hydroxybutyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 162227064 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 4-[(1S)-1-hydroxybutyl]benzene-1,2-diol;4-[(1R)-1-hydroxybutyl]benzene-1,2-diol |
| SMILES | CCC[C@@H](O)c1ccc(O)c(O)c1.CCC[C@H](O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/2C10H14O3/c2*1-2-3-8(11)7-4-5-9(12)10(13)6-7/h2*4-6,8,11-13H,2-3H2,1H3/t2*8-/m10/s1 |
| InChIKey | ZUXBQOUBIZICQL-RMTNWKGQSA-N |
| XLogP | 3.86 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|