C9H15NO4 — CID 18674898
4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;hydrate (PubChem CID 18674898) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is 4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;hydrate.
| Compound Name | 4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;hydrate |
|---|---|
| PubChem CID | 18674898 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;hydrate |
| SMILES | CNCC(O)c1ccc(O)c(O)c1.O |
| InChI | InChI=1S/C9H13NO3.H2O/c1-10-5-9(13)6-2-3-7(11)8(12)4-6;/h2-4,9-13H,5H2,1H3;1H2 |
| InChIKey | SLGFWXQRPFMMDN-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|