C9H19NO15S3 — CID 67900576
4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;sulfuric acid (PubChem CID 67900576) has the molecular formula C9H19NO15S3 and a molecular weight of 477.44 g/mol. Its IUPAC name is 4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;sulfuric acid.
| Compound Name | 4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;sulfuric acid |
|---|---|
| PubChem CID | 67900576 |
| Molecular Formula | C9H19NO15S3 |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 476.99 |
| IUPAC Name | 4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;sulfuric acid |
| SMILES | CNCC(O)c1ccc(O)c(O)c1.O=S(=O)(O)O.O=S(=O)(O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C9H13NO3.3H2O4S/c1-10-5-9(13)6-2-3-7(11)8(12)4-6;3*1-5(2,3)4/h2-4,9-13H,5H2,1H3;3*(H2,1,2,3,4) |
| InChIKey | FXRKRNWMHRTQTD-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 296.52 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|