C11H23N5O6S — CID 175014264
2-aminoguanidine;4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;methanesulfonic acid (PubChem CID 175014264) has the molecular formula C11H23N5O6S and a molecular weight of 353.40 g/mol. Its IUPAC name is 2-aminoguanidine;4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;methanesulfonic acid.
| Compound Name | 2-aminoguanidine;4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;methanesulfonic acid |
|---|---|
| PubChem CID | 175014264 |
| Molecular Formula | C11H23N5O6S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 2-aminoguanidine;4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;methanesulfonic acid |
| SMILES | CNCC(O)c1ccc(O)c(O)c1.CS(=O)(=O)O.NN=C(N)N |
| InChI | InChI=1S/C9H13NO3.CH6N4.CH4O3S/c1-10-5-9(13)6-2-3-7(11)8(12)4-6;2-1(3)5-4;1-5(2,3)4/h2-4,9-13H,5H2,1H3;4H2,(H4,2,3,5);1H3,(H,2,3,4) |
| InChIKey | NBXCNGCEGRYXOS-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 217.51 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|