C8H15NO11S2 — CID 67900579
4-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol;sulfuric acid (PubChem CID 67900579) has the molecular formula C8H15NO11S2 and a molecular weight of 365.34 g/mol. Its IUPAC name is 4-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol;sulfuric acid.
| Compound Name | 4-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol;sulfuric acid |
|---|---|
| PubChem CID | 67900579 |
| Molecular Formula | C8H15NO11S2 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 4-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol;sulfuric acid |
| SMILES | NC[C@H](O)c1ccc(O)c(O)c1.O=S(=O)(O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C8H11NO3.2H2O4S/c9-4-8(12)5-1-2-6(10)7(11)3-5;2*1-5(2,3)4/h1-3,8,10-12H,4,9H2;2*(H2,1,2,3,4)/t8-;;/m0../s1 |
| InChIKey | WPANYKFXTGAHDM-JZGIKJSDSA-N |
| XLogP | -1.22 |
| TPSA | 235.91 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|