C9H15ClN2O3S — CID 22852732
5-[(1R)-2-amino-1-hydroxyethyl]-2-methylbenzenesulfonamide;hydrochloride (PubChem CID 22852732) has the molecular formula C9H15ClN2O3S and a molecular weight of 266.75 g/mol. Its IUPAC name is 5-[(1R)-2-amino-1-hydroxyethyl]-2-methylbenzenesulfonamide;hydrochloride.
| Compound Name | 5-[(1R)-2-amino-1-hydroxyethyl]-2-methylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 22852732 |
| Molecular Formula | C9H15ClN2O3S |
| Molecular Weight | 266.75 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 5-[(1R)-2-amino-1-hydroxyethyl]-2-methylbenzenesulfonamide;hydrochloride |
| SMILES | Cc1ccc([C@@H](O)CN)cc1S(N)(=O)=O.Cl |
| InChI | InChI=1S/C9H14N2O3S.ClH/c1-6-2-3-7(8(12)5-10)4-9(6)15(11,13)14;/h2-4,8,12H,5,10H2,1H3,(H2,11,13,14);1H/t8-;/m0./s1 |
| InChIKey | RHVYFRJWAVFPNW-QRPNPIFTSA-N |
| XLogP | 0.06 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.75 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |