C18H25ClN2O5S — CID 70494607
5-[3-amino-1-hydroxy-4-(2-methoxyphenoxy)butyl]-2-methylbenzenesulfonamide;hydrochloride (PubChem CID 70494607) has the molecular formula C18H25ClN2O5S and a molecular weight of 416.93 g/mol. Its IUPAC name is 5-[3-amino-1-hydroxy-4-(2-methoxyphenoxy)butyl]-2-methylbenzenesulfonamide;hydrochloride.
| Compound Name | 5-[3-amino-1-hydroxy-4-(2-methoxyphenoxy)butyl]-2-methylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 70494607 |
| Molecular Formula | C18H25ClN2O5S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 5-[3-amino-1-hydroxy-4-(2-methoxyphenoxy)butyl]-2-methylbenzenesulfonamide;hydrochloride |
| SMILES | COc1ccccc1OCC(N)CC(O)c1ccc(C)c(S(N)(=O)=O)c1.Cl |
| InChI | InChI=1S/C18H24N2O5S.ClH/c1-12-7-8-13(9-18(12)26(20,22)23)15(21)10-14(19)11-25-17-6-4-3-5-16(17)24-2;/h3-9,14-15,21H,10-11,19H2,1-2H3,(H2,20,22,23);1H |
| InChIKey | JMGUTCCVPVYIMS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |