C13H21NO4 — CID 112629915
3-amino-1-(3,4-dimethoxyphenyl)-4-methoxybutan-1-ol (PubChem CID 112629915) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is 3-amino-1-(3,4-dimethoxyphenyl)-4-methoxybutan-1-ol.
| Compound Name | 3-amino-1-(3,4-dimethoxyphenyl)-4-methoxybutan-1-ol |
|---|---|
| PubChem CID | 112629915 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 3-amino-1-(3,4-dimethoxyphenyl)-4-methoxybutan-1-ol |
| SMILES | COCC(N)CC(O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C13H21NO4/c1-16-8-10(14)7-11(15)9-4-5-12(17-2)13(6-9)18-3/h4-6,10-11,15H,7-8,14H2,1-3H3 |
| InChIKey | NPWODGPANNOGLU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |