C12H16O5 — CID 174288850
[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl] acetate (PubChem CID 174288850) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-2-hydroxyethyl] acetate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-2-hydroxyethyl] acetate |
|---|---|
| PubChem CID | 174288850 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-2-hydroxyethyl] acetate |
| SMILES | COc1ccc(C(O)COC(C)=O)cc1OC |
| InChI | InChI=1S/C12H16O5/c1-8(13)17-7-10(14)9-4-5-11(15-2)12(6-9)16-3/h4-6,10,14H,7H2,1-3H3 |
| InChIKey | HOUPKHULRHQSDE-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |