C12H19NO3 — CID 40574216
(1S)-1-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethanol (PubChem CID 40574216) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is (1S)-1-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethanol.
| Compound Name | (1S)-1-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethanol |
|---|---|
| PubChem CID | 40574216 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | (1S)-1-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethanol |
| SMILES | COc1ccc([C@H](O)CN(C)C)cc1OC |
| InChI | InChI=1S/C12H19NO3/c1-13(2)8-10(14)9-5-6-11(15-3)12(7-9)16-4/h5-7,10,14H,8H2,1-4H3/t10-/m1/s1 |
| InChIKey | YAIPYAQVBZPSSC-SNVBAGLBSA-N |
| XLogP | 1.30 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |