C12H18ClNO2 — CID 82214956
2-chloro-2-(3,4-dimethoxyphenyl)-N,N-dimethylethanamine (PubChem CID 82214956) has the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. Its IUPAC name is 2-chloro-2-(3,4-dimethoxyphenyl)-N,N-dimethylethanamine.
| Compound Name | 2-chloro-2-(3,4-dimethoxyphenyl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 82214956 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 2-chloro-2-(3,4-dimethoxyphenyl)-N,N-dimethylethanamine |
| SMILES | COc1ccc(C(Cl)CN(C)C)cc1OC |
| InChI | InChI=1S/C12H18ClNO2/c1-14(2)8-10(13)9-5-6-11(15-3)12(7-9)16-4/h5-7,10H,8H2,1-4H3 |
| InChIKey | FVETUGOJDFEWSL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|