C11H17NO2S — CID 116909365
(3,4-dimethoxyphenyl)-(dimethylamino)methanethiol (PubChem CID 116909365) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-(dimethylamino)methanethiol.
| Compound Name | (3,4-dimethoxyphenyl)-(dimethylamino)methanethiol |
|---|---|
| PubChem CID | 116909365 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | (3,4-dimethoxyphenyl)-(dimethylamino)methanethiol |
| SMILES | COc1ccc(C(S)N(C)C)cc1OC |
| InChI | InChI=1S/C11H17NO2S/c1-12(2)11(15)8-5-6-9(13-3)10(7-8)14-4/h5-7,11,15H,1-4H3 |
| InChIKey | SNMZJPYKQZFLAK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 21.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|