C24H36O4 — CID 54391207
4-butan-2-yl-1,2-dimethoxybenzene (PubChem CID 54391207) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is 4-butan-2-yl-1,2-dimethoxybenzene.
| Compound Name | 4-butan-2-yl-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 54391207 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 4-butan-2-yl-1,2-dimethoxybenzene |
| SMILES | CCC(C)c1ccc(OC)c(OC)c1.CCC(C)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/2C12H18O2/c2*1-5-9(2)10-6-7-11(13-3)12(8-10)14-4/h2*6-9H,5H2,1-4H3 |
| InChIKey | VGTLETQEEIIZDB-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |