C12H20ClNO2 — CID 3056377
3-(3,4-dimethoxyphenyl)butan-1-amine;hydrochloride (PubChem CID 3056377) has the molecular formula C12H20ClNO2 and a molecular weight of 245.75 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)butan-1-amine;hydrochloride.
| Compound Name | 3-(3,4-dimethoxyphenyl)butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 3056377 |
| Molecular Formula | C12H20ClNO2 |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)butan-1-amine;hydrochloride |
| SMILES | COc1ccc(C(C)CCN)cc1OC.Cl |
| InChI | InChI=1S/C12H19NO2.ClH/c1-9(6-7-13)10-4-5-11(14-2)12(8-10)15-3;/h4-5,8-9H,6-7,13H2,1-3H3;1H |
| InChIKey | DTGUXVDMPVMFLE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |