C13H20O2 — CID 23378350
1,2-dimethoxy-4-(3-methylbutan-2-yl)benzene (PubChem CID 23378350) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 1,2-dimethoxy-4-(3-methylbutan-2-yl)benzene.
| Compound Name | 1,2-dimethoxy-4-(3-methylbutan-2-yl)benzene |
|---|---|
| PubChem CID | 23378350 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 1,2-dimethoxy-4-(3-methylbutan-2-yl)benzene |
| SMILES | COc1ccc(C(C)C(C)C)cc1OC |
| InChI | InChI=1S/C13H20O2/c1-9(2)10(3)11-6-7-12(14-4)13(8-11)15-5/h6-10H,1-5H3 |
| InChIKey | FFLHIRRYBAVOEU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |