C13H22NO2+ — CID 23378141
[1-(3,4-dimethoxyphenyl)-3-methylbutyl]azanium (PubChem CID 23378141) has the molecular formula C13H22NO2+ and a molecular weight of 224.32 g/mol. Its IUPAC name is [1-(3,4-dimethoxyphenyl)-3-methylbutyl]azanium.
| Compound Name | [1-(3,4-dimethoxyphenyl)-3-methylbutyl]azanium |
|---|---|
| PubChem CID | 23378141 |
| Molecular Formula | C13H22NO2+ |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | [1-(3,4-dimethoxyphenyl)-3-methylbutyl]azanium |
| SMILES | COc1ccc(C([NH3+])CC(C)C)cc1OC |
| InChI | InChI=1S/C13H21NO2/c1-9(2)7-11(14)10-5-6-12(15-3)13(8-10)16-4/h5-6,8-9,11H,7,14H2,1-4H3/p+1 |
| InChIKey | OQZRVXOBELFACE-UHFFFAOYSA-O |
| XLogP | 2.03 |
| TPSA | 46.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |