C12H18NO4+ — CID 7131802
[(1S)-1-(3,4-dimethoxyphenyl)-3-methoxy-3-oxopropyl]azanium (PubChem CID 7131802) has the molecular formula C12H18NO4+ and a molecular weight of 240.28 g/mol. Its IUPAC name is [(1S)-1-(3,4-dimethoxyphenyl)-3-methoxy-3-oxopropyl]azanium.
| Compound Name | [(1S)-1-(3,4-dimethoxyphenyl)-3-methoxy-3-oxopropyl]azanium |
|---|---|
| PubChem CID | 7131802 |
| Molecular Formula | C12H18NO4+ |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | [(1S)-1-(3,4-dimethoxyphenyl)-3-methoxy-3-oxopropyl]azanium |
| SMILES | COC(=O)C[C@H]([NH3+])c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C12H17NO4/c1-15-10-5-4-8(6-11(10)16-2)9(13)7-12(14)17-3/h4-6,9H,7,13H2,1-3H3/p+1/t9-/m0/s1 |
| InChIKey | DPDHEFCLHFWWJB-VIFPVBQESA-O |
| XLogP | 0.55 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |