C10H13NO4 — CID 25418563
(3S)-3-azaniumyl-3-(4-hydroxy-3-methoxyphenyl)propanoate (PubChem CID 25418563) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is (3S)-3-azaniumyl-3-(4-hydroxy-3-methoxyphenyl)propanoate.
| Compound Name | (3S)-3-azaniumyl-3-(4-hydroxy-3-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 25418563 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | (3S)-3-azaniumyl-3-(4-hydroxy-3-methoxyphenyl)propanoate |
| SMILES | COc1cc([C@@H]([NH3+])CC(=O)[O-])ccc1O |
| InChI | InChI=1S/C10H13NO4/c1-15-9-4-6(2-3-8(9)12)7(11)5-10(13)14/h2-4,7,12H,5,11H2,1H3,(H,13,14)/t7-/m0/s1 |
| InChIKey | IGHHJKPPALHKMJ-ZETCQYMHSA-N |
| XLogP | -1.18 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |