C12H16BrNO3 — CID 29011113
(5R)-5-azaniumyl-5-(3-bromo-4-methoxyphenyl)pentanoate (PubChem CID 29011113) has the molecular formula C12H16BrNO3 and a molecular weight of 302.17 g/mol. Its IUPAC name is (5R)-5-azaniumyl-5-(3-bromo-4-methoxyphenyl)pentanoate.
| Compound Name | (5R)-5-azaniumyl-5-(3-bromo-4-methoxyphenyl)pentanoate |
|---|---|
| PubChem CID | 29011113 |
| Molecular Formula | C12H16BrNO3 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | (5R)-5-azaniumyl-5-(3-bromo-4-methoxyphenyl)pentanoate |
| SMILES | COc1ccc([C@H]([NH3+])CCCC(=O)[O-])cc1Br |
| InChI | InChI=1S/C12H16BrNO3/c1-17-11-6-5-8(7-9(11)13)10(14)3-2-4-12(15)16/h5-7,10H,2-4,14H2,1H3,(H,15,16)/t10-/m1/s1 |
| InChIKey | YQBRSXQENGUGIJ-SNVBAGLBSA-N |
| XLogP | 0.66 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |