C12H16BrNO4 — CID 28934534
(4R)-4-azaniumyl-4-(2-bromo-4,5-dimethoxyphenyl)butanoate (PubChem CID 28934534) has the molecular formula C12H16BrNO4 and a molecular weight of 318.17 g/mol. Its IUPAC name is (4R)-4-azaniumyl-4-(2-bromo-4,5-dimethoxyphenyl)butanoate.
| Compound Name | (4R)-4-azaniumyl-4-(2-bromo-4,5-dimethoxyphenyl)butanoate |
|---|---|
| PubChem CID | 28934534 |
| Molecular Formula | C12H16BrNO4 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | (4R)-4-azaniumyl-4-(2-bromo-4,5-dimethoxyphenyl)butanoate |
| SMILES | COc1cc(Br)c([C@H]([NH3+])CCC(=O)[O-])cc1OC |
| InChI | InChI=1S/C12H16BrNO4/c1-17-10-5-7(8(13)6-11(10)18-2)9(14)3-4-12(15)16/h5-6,9H,3-4,14H2,1-2H3,(H,15,16)/t9-/m1/s1 |
| InChIKey | VHADHOAZSMGBFH-SECBINFHSA-N |
| XLogP | 0.28 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |