2-(2-bromo-4,5-dimethoxyphenyl)-2-propoxyacetic acid

C13H17BrO5 — CID 83223781

IUPAC2-(2-bromo-4,5-dimethoxyphenyl)-2-propoxyacetic acid
SMILESCCCOC(C(=O)O)c1cc(OC)c(OC)cc1Br
InChIInChI=1S/C13H17BrO5/c1-4-5-19-12(13(15)16)8-6-10(17-2)11(18-3)7-9(8)14/h6-7,12H,4-5H2,1-3H3,(H,15,16)
InChIKeyFLOLHOVADRAQIM-UHFFFAOYSA-N
MW333.18 g/mol
LogP3.02
Rot. Bonds7

About 2-(2-bromo-4,5-dimethoxyphenyl)-2-propoxyacetic acid

2-(2-bromo-4,5-dimethoxyphenyl)-2-propoxyacetic acid (PubChem CID 83223781) has the molecular formula C13H17BrO5 and a molecular weight of 333.18 g/mol. Its IUPAC name is 2-(2-bromo-4,5-dimethoxyphenyl)-2-propoxyacetic acid.

Molecular Properties

Compound Name2-(2-bromo-4,5-dimethoxyphenyl)-2-propoxyacetic acid
PubChem CID83223781
Molecular FormulaC13H17BrO5
Molecular Weight333.18 g/mol
Exact Mass332.03
IUPAC Name2-(2-bromo-4,5-dimethoxyphenyl)-2-propoxyacetic acid
SMILESCCCOC(C(=O)O)c1cc(OC)c(OC)cc1Br
InChIInChI=1S/C13H17BrO5/c1-4-5-19-12(13(15)16)8-6-10(17-2)11(18-3)7-9(8)14/h6-7,12H,4-5H2,1-3H3,(H,15,16)
InChIKeyFLOLHOVADRAQIM-UHFFFAOYSA-N
XLogP3.02
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500333.18
LogP ≤ 53.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(2-bromo-4,5-dimethoxyphenyl)-2-propoxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-bromo-4,5-dimethoxyphenyl)-2-propoxyacetic acid?
The IUPAC name of 2-(2-bromo-4,5-dimethoxyphenyl)-2-propoxyacetic acid (CID 83223781) is 2-(2-bromo-4,5-dimethoxyphenyl)-2-propoxyacetic acid.
What is the SMILES notation for 2-(2-bromo-4,5-dimethoxyphenyl)-2-propoxyacetic acid?
The canonical SMILES for 2-(2-bromo-4,5-dimethoxyphenyl)-2-propoxyacetic acid is CCCOC(C(=O)O)c1cc(OC)c(OC)cc1Br.
What is the InChIKey of 2-(2-bromo-4,5-dimethoxyphenyl)-2-propoxyacetic acid?
The InChIKey is FLOLHOVADRAQIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17BrO5/c1-4-5-19-12(13(15)16)8-6-10(17-2)11(18-3)7-9(8)14/h6-7,12H,4-5H2,1-3H3,(H,15,16).
What are the key properties of 2-(2-bromo-4,5-dimethoxyphenyl)-2-propoxyacetic acid?
2-(2-bromo-4,5-dimethoxyphenyl)-2-propoxyacetic acid has a molecular weight of 333.18 g/mol, XLogP of 3.02, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromo-4,5-dimethoxyphenyl)-2-propoxyacetic acid is sourced from PubChem (CID 83223781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).