2-methoxy-2-(2,4,5-trimethoxyphenyl)acetic acid

C12H16O6 — CID 116769401

IUPAC2-methoxy-2-(2,4,5-trimethoxyphenyl)acetic acid
SMILESCOc1cc(OC)c(C(OC)C(=O)O)cc1OC
InChIInChI=1S/C12H16O6/c1-15-8-6-10(17-3)9(16-2)5-7(8)11(18-4)12(13)14/h5-6,11H,1-4H3,(H,13,14)
InChIKeyIEIFYLNJQTUVOS-UHFFFAOYSA-N
MW256.25 g/mol
LogP1.48
Rot. Bonds6

About 2-methoxy-2-(2,4,5-trimethoxyphenyl)acetic acid

2-methoxy-2-(2,4,5-trimethoxyphenyl)acetic acid (PubChem CID 116769401) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is 2-methoxy-2-(2,4,5-trimethoxyphenyl)acetic acid.

Molecular Properties

Compound Name2-methoxy-2-(2,4,5-trimethoxyphenyl)acetic acid
PubChem CID116769401
Molecular FormulaC12H16O6
Molecular Weight256.25 g/mol
Exact Mass256.09
IUPAC Name2-methoxy-2-(2,4,5-trimethoxyphenyl)acetic acid
SMILESCOc1cc(OC)c(C(OC)C(=O)O)cc1OC
InChIInChI=1S/C12H16O6/c1-15-8-6-10(17-3)9(16-2)5-7(8)11(18-4)12(13)14/h5-6,11H,1-4H3,(H,13,14)
InChIKeyIEIFYLNJQTUVOS-UHFFFAOYSA-N
XLogP1.48
TPSA74.22 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.25
LogP ≤ 51.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-methoxy-2-(2,4,5-trimethoxyphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methoxy-2-(2,4,5-trimethoxyphenyl)acetic acid?
The IUPAC name of 2-methoxy-2-(2,4,5-trimethoxyphenyl)acetic acid (CID 116769401) is 2-methoxy-2-(2,4,5-trimethoxyphenyl)acetic acid.
What is the SMILES notation for 2-methoxy-2-(2,4,5-trimethoxyphenyl)acetic acid?
The canonical SMILES for 2-methoxy-2-(2,4,5-trimethoxyphenyl)acetic acid is COc1cc(OC)c(C(OC)C(=O)O)cc1OC.
What is the InChIKey of 2-methoxy-2-(2,4,5-trimethoxyphenyl)acetic acid?
The InChIKey is IEIFYLNJQTUVOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O6/c1-15-8-6-10(17-3)9(16-2)5-7(8)11(18-4)12(13)14/h5-6,11H,1-4H3,(H,13,14).
What are the key properties of 2-methoxy-2-(2,4,5-trimethoxyphenyl)acetic acid?
2-methoxy-2-(2,4,5-trimethoxyphenyl)acetic acid has a molecular weight of 256.25 g/mol, XLogP of 1.48, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-2-(2,4,5-trimethoxyphenyl)acetic acid is sourced from PubChem (CID 116769401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).