C12H16O6 — CID 116769401
2-methoxy-2-(2,4,5-trimethoxyphenyl)acetic acid (PubChem CID 116769401) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is 2-methoxy-2-(2,4,5-trimethoxyphenyl)acetic acid.
| Compound Name | 2-methoxy-2-(2,4,5-trimethoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 116769401 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 2-methoxy-2-(2,4,5-trimethoxyphenyl)acetic acid |
| SMILES | COc1cc(OC)c(C(OC)C(=O)O)cc1OC |
| InChI | InChI=1S/C12H16O6/c1-15-8-6-10(17-3)9(16-2)5-7(8)11(18-4)12(13)14/h5-6,11H,1-4H3,(H,13,14) |
| InChIKey | IEIFYLNJQTUVOS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |