C12H16O5 — CID 46848158
(1R)-1-hydroxy-1-(2,4,5-trimethoxyphenyl)propan-2-one (PubChem CID 46848158) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is (1R)-1-hydroxy-1-(2,4,5-trimethoxyphenyl)propan-2-one.
| Compound Name | (1R)-1-hydroxy-1-(2,4,5-trimethoxyphenyl)propan-2-one |
|---|---|
| PubChem CID | 46848158 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (1R)-1-hydroxy-1-(2,4,5-trimethoxyphenyl)propan-2-one |
| SMILES | COc1cc(OC)c([C@@H](O)C(C)=O)cc1OC |
| InChI | InChI=1S/C12H16O5/c1-7(13)12(14)8-5-10(16-3)11(17-4)6-9(8)15-2/h5-6,12,14H,1-4H3/t12-/m0/s1 |
| InChIKey | LVZSTCWLAWIFNV-LBPRGKRZSA-N |
| XLogP | 1.33 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |