C16H22O4 — CID 66552557
(3S,4S)-4-methyl-3-(2,4,5-trimethoxyphenyl)hex-5-en-2-one (PubChem CID 66552557) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (3S,4S)-4-methyl-3-(2,4,5-trimethoxyphenyl)hex-5-en-2-one.
| Compound Name | (3S,4S)-4-methyl-3-(2,4,5-trimethoxyphenyl)hex-5-en-2-one |
|---|---|
| PubChem CID | 66552557 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (3S,4S)-4-methyl-3-(2,4,5-trimethoxyphenyl)hex-5-en-2-one |
| SMILES | C=C[C@H](C)[C@H](C(C)=O)c1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C16H22O4/c1-7-10(2)16(11(3)17)12-8-14(19-5)15(20-6)9-13(12)18-4/h7-10,16H,1H2,2-6H3/t10-,16+/m0/s1 |
| InChIKey | MWCYOSIIJOKPIL-MGPLVRAMSA-N |
| XLogP | 3.21 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|