C13H19NO5 — CID 43753940
2-(ethylamino)-2-(2,4,5-trimethoxyphenyl)acetic acid (PubChem CID 43753940) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-(ethylamino)-2-(2,4,5-trimethoxyphenyl)acetic acid.
| Compound Name | 2-(ethylamino)-2-(2,4,5-trimethoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 43753940 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-(ethylamino)-2-(2,4,5-trimethoxyphenyl)acetic acid |
| SMILES | CCNC(C(=O)O)c1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C13H19NO5/c1-5-14-12(13(15)16)8-6-10(18-3)11(19-4)7-9(8)17-2/h6-7,12,14H,5H2,1-4H3,(H,15,16) |
| InChIKey | CJWKIGGNJGJRSD-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |