C14H21NO5 — CID 65233872
3-(ethylamino)-3-(2,4,5-trimethoxyphenyl)propanoic acid (PubChem CID 65233872) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is 3-(ethylamino)-3-(2,4,5-trimethoxyphenyl)propanoic acid.
| Compound Name | 3-(ethylamino)-3-(2,4,5-trimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 65233872 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 3-(ethylamino)-3-(2,4,5-trimethoxyphenyl)propanoic acid |
| SMILES | CCNC(CC(=O)O)c1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C14H21NO5/c1-5-15-10(7-14(16)17)9-6-12(19-3)13(20-4)8-11(9)18-2/h6,8,10,15H,5,7H2,1-4H3,(H,16,17) |
| InChIKey | JGPJHXXWQVPMIH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |