3-(ethylamino)-3-(2,4,5-trimethoxyphenyl)propanoic acid

C14H21NO5 — CID 65233872

IUPAC3-(ethylamino)-3-(2,4,5-trimethoxyphenyl)propanoic acid
SMILESCCNC(CC(=O)O)c1cc(OC)c(OC)cc1OC
InChIInChI=1S/C14H21NO5/c1-5-15-10(7-14(16)17)9-6-12(19-3)13(20-4)8-11(9)18-2/h6,8,10,15H,5,7H2,1-4H3,(H,16,17)
InChIKeyJGPJHXXWQVPMIH-UHFFFAOYSA-N
MW283.32 g/mol
LogP1.84
Rot. Bonds8

About 3-(ethylamino)-3-(2,4,5-trimethoxyphenyl)propanoic acid

3-(ethylamino)-3-(2,4,5-trimethoxyphenyl)propanoic acid (PubChem CID 65233872) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is 3-(ethylamino)-3-(2,4,5-trimethoxyphenyl)propanoic acid.

Molecular Properties

Compound Name3-(ethylamino)-3-(2,4,5-trimethoxyphenyl)propanoic acid
PubChem CID65233872
Molecular FormulaC14H21NO5
Molecular Weight283.32 g/mol
Exact Mass283.14
IUPAC Name3-(ethylamino)-3-(2,4,5-trimethoxyphenyl)propanoic acid
SMILESCCNC(CC(=O)O)c1cc(OC)c(OC)cc1OC
InChIInChI=1S/C14H21NO5/c1-5-15-10(7-14(16)17)9-6-12(19-3)13(20-4)8-11(9)18-2/h6,8,10,15H,5,7H2,1-4H3,(H,16,17)
InChIKeyJGPJHXXWQVPMIH-UHFFFAOYSA-N
XLogP1.84
TPSA77.02 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.32
LogP ≤ 51.84
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 3-(ethylamino)-3-(2,4,5-trimethoxyphenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(ethylamino)-3-(2,4,5-trimethoxyphenyl)propanoic acid?
The IUPAC name of 3-(ethylamino)-3-(2,4,5-trimethoxyphenyl)propanoic acid (CID 65233872) is 3-(ethylamino)-3-(2,4,5-trimethoxyphenyl)propanoic acid.
What is the SMILES notation for 3-(ethylamino)-3-(2,4,5-trimethoxyphenyl)propanoic acid?
The canonical SMILES for 3-(ethylamino)-3-(2,4,5-trimethoxyphenyl)propanoic acid is CCNC(CC(=O)O)c1cc(OC)c(OC)cc1OC.
What is the InChIKey of 3-(ethylamino)-3-(2,4,5-trimethoxyphenyl)propanoic acid?
The InChIKey is JGPJHXXWQVPMIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO5/c1-5-15-10(7-14(16)17)9-6-12(19-3)13(20-4)8-11(9)18-2/h6,8,10,15H,5,7H2,1-4H3,(H,16,17).
What are the key properties of 3-(ethylamino)-3-(2,4,5-trimethoxyphenyl)propanoic acid?
3-(ethylamino)-3-(2,4,5-trimethoxyphenyl)propanoic acid has a molecular weight of 283.32 g/mol, XLogP of 1.84, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethylamino)-3-(2,4,5-trimethoxyphenyl)propanoic acid is sourced from PubChem (CID 65233872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).