C13H22N2O3 — CID 116934954
N'-ethyl-1-(2,4,5-trimethoxyphenyl)ethane-1,2-diamine (PubChem CID 116934954) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is N'-ethyl-1-(2,4,5-trimethoxyphenyl)ethane-1,2-diamine.
| Compound Name | N'-ethyl-1-(2,4,5-trimethoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 116934954 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | N'-ethyl-1-(2,4,5-trimethoxyphenyl)ethane-1,2-diamine |
| SMILES | CCNCC(N)c1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C13H22N2O3/c1-5-15-8-10(14)9-6-12(17-3)13(18-4)7-11(9)16-2/h6-7,10,15H,5,8,14H2,1-4H3 |
| InChIKey | GZCXNDYYDPUMIB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |